C19H27ClN2O2 — CID 51865236
2-chloro-N-[(2R)-3-methyl-1-[(4-methylcyclohexyl)amino]-1-oxobutan-2-yl]benzamide (PubChem CID 51865236) has the molecular formula C19H27ClN2O2 and a molecular weight of 350.89 g/mol. Its IUPAC name is 2-chloro-N-[(2R)-3-methyl-1-[(4-methylcyclohexyl)amino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[(2R)-3-methyl-1-[(4-methylcyclohexyl)amino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 51865236 |
| Molecular Formula | C19H27ClN2O2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-chloro-N-[(2R)-3-methyl-1-[(4-methylcyclohexyl)amino]-1-oxobutan-2-yl]benzamide |
| SMILES | CC1CCC(NC(=O)[C@H](NC(=O)c2ccccc2Cl)C(C)C)CC1 |
| InChI | InChI=1S/C19H27ClN2O2/c1-12(2)17(19(24)21-14-10-8-13(3)9-11-14)22-18(23)15-6-4-5-7-16(15)20/h4-7,12-14,17H,8-11H2,1-3H3,(H,21,24)(H,22,23)/t13?,14?,17-/m1/s1 |
| InChIKey | ANPVHKDSNDDNME-MQBCKMQZSA-N |
| XLogP | 3.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |