C17H22Cl2N2O2 — CID 55739288
2,3-dichloro-N-[1-[(4-methylcyclohexyl)amino]-1-oxopropan-2-yl]benzamide (PubChem CID 55739288) has the molecular formula C17H22Cl2N2O2 and a molecular weight of 357.28 g/mol. Its IUPAC name is 2,3-dichloro-N-[1-[(4-methylcyclohexyl)amino]-1-oxopropan-2-yl]benzamide.
| Compound Name | 2,3-dichloro-N-[1-[(4-methylcyclohexyl)amino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 55739288 |
| Molecular Formula | C17H22Cl2N2O2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2,3-dichloro-N-[1-[(4-methylcyclohexyl)amino]-1-oxopropan-2-yl]benzamide |
| SMILES | CC1CCC(NC(=O)C(C)NC(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O2/c1-10-6-8-12(9-7-10)21-16(22)11(2)20-17(23)13-4-3-5-14(18)15(13)19/h3-5,10-12H,6-9H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | CJNCDFJKLXWEAD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |