C14H17Cl2NO3 — CID 81003606
tert-butyl (2R)-2-[(2,3-dichlorobenzoyl)amino]propanoate (PubChem CID 81003606) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2,3-dichlorobenzoyl)amino]propanoate.
| Compound Name | tert-butyl (2R)-2-[(2,3-dichlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 81003606 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | tert-butyl (2R)-2-[(2,3-dichlorobenzoyl)amino]propanoate |
| SMILES | C[C@@H](NC(=O)c1cccc(Cl)c1Cl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H17Cl2NO3/c1-8(13(19)20-14(2,3)4)17-12(18)9-6-5-7-10(15)11(9)16/h5-8H,1-4H3,(H,17,18)/t8-/m1/s1 |
| InChIKey | BXGVGYOPBIEPSX-MRVPVSSYSA-N |
| XLogP | 3.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |