C14H19ClN2O3 — CID 103873980
tert-butyl (2S)-2-[(4-chloro-6-methylpyridine-3-carbonyl)amino]propanoate (PubChem CID 103873980) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(4-chloro-6-methylpyridine-3-carbonyl)amino]propanoate.
| Compound Name | tert-butyl (2S)-2-[(4-chloro-6-methylpyridine-3-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 103873980 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | tert-butyl (2S)-2-[(4-chloro-6-methylpyridine-3-carbonyl)amino]propanoate |
| SMILES | Cc1cc(Cl)c(C(=O)N[C@@H](C)C(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C14H19ClN2O3/c1-8-6-11(15)10(7-16-8)12(18)17-9(2)13(19)20-14(3,4)5/h6-7,9H,1-5H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | UYUBXGMGFQNDHA-VIFPVBQESA-N |
| XLogP | 2.50 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |