C14H16ClF2NO3 — CID 80998906
tert-butyl (2R)-2-[(2-chloro-4,5-difluorobenzoyl)amino]propanoate (PubChem CID 80998906) has the molecular formula C14H16ClF2NO3 and a molecular weight of 319.74 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2-chloro-4,5-difluorobenzoyl)amino]propanoate.
| Compound Name | tert-butyl (2R)-2-[(2-chloro-4,5-difluorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 80998906 |
| Molecular Formula | C14H16ClF2NO3 |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | tert-butyl (2R)-2-[(2-chloro-4,5-difluorobenzoyl)amino]propanoate |
| SMILES | C[C@@H](NC(=O)c1cc(F)c(F)cc1Cl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H16ClF2NO3/c1-7(13(20)21-14(2,3)4)18-12(19)8-5-10(16)11(17)6-9(8)15/h5-7H,1-4H3,(H,18,19)/t7-/m1/s1 |
| InChIKey | ATAPXBBWBOCPIX-SSDOTTSWSA-N |
| XLogP | 3.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|