About N-[(2S)-1-amino-1-oxopropan-2-yl]-4-chloro-2,5-difluorobenzamide
N-[(2S)-1-amino-1-oxopropan-2-yl]-4-chloro-2,5-difluorobenzamide (PubChem CID 86785546) has the molecular formula C10H9ClF2N2O2
and a molecular weight of 262.64 g/mol. Its IUPAC name is N-[(2S)-1-amino-1-oxopropan-2-yl]-4-chloro-2,5-difluorobenzamide.
Molecular Properties
| Compound Name | N-[(2S)-1-amino-1-oxopropan-2-yl]-4-chloro-2,5-difluorobenzamide |
| PubChem CID | 86785546 |
| Molecular Formula | C10H9ClF2N2O2 |
| Molecular Weight | 262.64 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | N-[(2S)-1-amino-1-oxopropan-2-yl]-4-chloro-2,5-difluorobenzamide |
| SMILES | C[C@H](NC(=O)c1cc(F)c(Cl)cc1F)C(N)=O |
| InChI | InChI=1S/C10H9ClF2N2O2/c1-4(9(14)16)15-10(17)5-2-8(13)6(11)3-7(5)12/h2-4H,1H3,(H2,14,16)(H,15,17)/t4-/m0/s1 |
| InChIKey | FUCCTOYKDJFYPY-BYPYZUCNSA-N |
| XLogP | 1.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.64 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-1-amino-1-oxopropan-2-yl]-4-chloro-2,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-1-amino-1-oxopropan-2-yl]-4-chloro-2,5-difluorobenzamide?
The IUPAC name of N-[(2S)-1-amino-1-oxopropan-2-yl]-4-chloro-2,5-difluorobenzamide (CID 86785546) is N-[(2S)-1-amino-1-oxopropan-2-yl]-4-chloro-2,5-difluorobenzamide.
What is the SMILES notation for N-[(2S)-1-amino-1-oxopropan-2-yl]-4-chloro-2,5-difluorobenzamide?
The canonical SMILES for N-[(2S)-1-amino-1-oxopropan-2-yl]-4-chloro-2,5-difluorobenzamide is C[C@H](NC(=O)c1cc(F)c(Cl)cc1F)C(N)=O.
What is the InChIKey of N-[(2S)-1-amino-1-oxopropan-2-yl]-4-chloro-2,5-difluorobenzamide?
The InChIKey is FUCCTOYKDJFYPY-BYPYZUCNSA-N. The full InChI is InChI=1S/C10H9ClF2N2O2/c1-4(9(14)16)15-10(17)5-2-8(13)6(11)3-7(5)12/h2-4H,1H3,(H2,14,16)(H,15,17)/t4-/m0/s1.
What are the key properties of N-[(2S)-1-amino-1-oxopropan-2-yl]-4-chloro-2,5-difluorobenzamide?
N-[(2S)-1-amino-1-oxopropan-2-yl]-4-chloro-2,5-difluorobenzamide has a molecular weight of 262.64 g/mol, XLogP of 1.22, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-1-amino-1-oxopropan-2-yl]-4-chloro-2,5-difluorobenzamide is sourced from PubChem (CID 86785546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).