C10H12FN3O2 — CID 62661518
2-amino-N-(1-amino-1-oxopropan-2-yl)-3-fluorobenzamide (PubChem CID 62661518) has the molecular formula C10H12FN3O2 and a molecular weight of 225.22 g/mol. Its IUPAC name is 2-amino-N-(1-amino-1-oxopropan-2-yl)-3-fluorobenzamide.
| Compound Name | 2-amino-N-(1-amino-1-oxopropan-2-yl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 62661518 |
| Molecular Formula | C10H12FN3O2 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2-amino-N-(1-amino-1-oxopropan-2-yl)-3-fluorobenzamide |
| SMILES | CC(NC(=O)c1cccc(F)c1N)C(N)=O |
| InChI | InChI=1S/C10H12FN3O2/c1-5(9(13)15)14-10(16)6-3-2-4-7(11)8(6)12/h2-5H,12H2,1H3,(H2,13,15)(H,14,16) |
| InChIKey | VPRGAYLBTZURBD-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|