C9H12FN3O — CID 83021184
2-amino-3-fluoro-N',N'-dimethylbenzohydrazide (PubChem CID 83021184) has the molecular formula C9H12FN3O and a molecular weight of 197.21 g/mol. Its IUPAC name is 2-amino-3-fluoro-N',N'-dimethylbenzohydrazide.
| Compound Name | 2-amino-3-fluoro-N',N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 83021184 |
| Molecular Formula | C9H12FN3O |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-amino-3-fluoro-N',N'-dimethylbenzohydrazide |
| SMILES | CN(C)NC(=O)c1cccc(F)c1N |
| InChI | InChI=1S/C9H12FN3O/c1-13(2)12-9(14)6-4-3-5-7(10)8(6)11/h3-5H,11H2,1-2H3,(H,12,14) |
| InChIKey | FNLQKGQRUCMMJB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|