C11H14FN3O2 — CID 55099722
2-amino-3-fluoro-N-[3-(methylamino)-3-oxopropyl]benzamide (PubChem CID 55099722) has the molecular formula C11H14FN3O2 and a molecular weight of 239.25 g/mol. Its IUPAC name is 2-amino-3-fluoro-N-[3-(methylamino)-3-oxopropyl]benzamide.
| Compound Name | 2-amino-3-fluoro-N-[3-(methylamino)-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 55099722 |
| Molecular Formula | C11H14FN3O2 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-amino-3-fluoro-N-[3-(methylamino)-3-oxopropyl]benzamide |
| SMILES | CNC(=O)CCNC(=O)c1cccc(F)c1N |
| InChI | InChI=1S/C11H14FN3O2/c1-14-9(16)5-6-15-11(17)7-3-2-4-8(12)10(7)13/h2-4H,5-6,13H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | PNLQRFCJOPRBOG-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|