C10H11BrFN3O2 — CID 55118572
5-amino-N-(1-amino-1-oxopropan-2-yl)-2-bromo-4-fluorobenzamide (PubChem CID 55118572) has the molecular formula C10H11BrFN3O2 and a molecular weight of 304.12 g/mol. Its IUPAC name is 5-amino-N-(1-amino-1-oxopropan-2-yl)-2-bromo-4-fluorobenzamide.
| Compound Name | 5-amino-N-(1-amino-1-oxopropan-2-yl)-2-bromo-4-fluorobenzamide |
|---|---|
| PubChem CID | 55118572 |
| Molecular Formula | C10H11BrFN3O2 |
| Molecular Weight | 304.12 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 5-amino-N-(1-amino-1-oxopropan-2-yl)-2-bromo-4-fluorobenzamide |
| SMILES | CC(NC(=O)c1cc(N)c(F)cc1Br)C(N)=O |
| InChI | InChI=1S/C10H11BrFN3O2/c1-4(9(14)16)15-10(17)5-2-8(13)7(12)3-6(5)11/h2-4H,13H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | ISKIZEZGUYLZBO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.12 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|