C15H16BrFN2OS — CID 62815438
5-amino-2-bromo-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-fluorobenzamide (PubChem CID 62815438) has the molecular formula C15H16BrFN2OS and a molecular weight of 371.30 g/mol. Its IUPAC name is 5-amino-2-bromo-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-fluorobenzamide.
| Compound Name | 5-amino-2-bromo-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 62815438 |
| Molecular Formula | C15H16BrFN2OS |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 5-amino-2-bromo-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-fluorobenzamide |
| SMILES | CC1=CC(=C(S1)C)C(C)NC(=O)C2=CC(=C(C=C2Br)F)N |
| InChI | InChI=1S/C15H16BrFN2OS/c1-7-4-10(9(3)21-7)8(2)19-15(20)11-5-14(18)13(17)6-12(11)16/h4-6,8H,18H2,1-3H3,(H,19,20) |
| InChIKey | JJGRANCUMZSKPJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | 387 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|