C14H14ClFN2OS — CID 103891941
2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-fluoropyridine-3-carboxamide (PubChem CID 103891941) has the molecular formula C14H14ClFN2OS and a molecular weight of 312.80 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-fluoropyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 103891941 |
| Molecular Formula | C14H14ClFN2OS |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-fluoropyridine-3-carboxamide |
| SMILES | Cc1cc(C(C)NC(=O)c2cc(F)cnc2Cl)c(C)s1 |
| InChI | InChI=1S/C14H14ClFN2OS/c1-7-4-11(9(3)20-7)8(2)18-14(19)12-5-10(16)6-17-13(12)15/h4-6,8H,1-3H3,(H,18,19) |
| InChIKey | SOSOJFWFRLTJIU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|