C17H24N2OS2 — CID 71897547
1,3-bis[1-(2,5-dimethylthiophen-3-yl)ethyl]urea (PubChem CID 71897547) has the molecular formula C17H24N2OS2 and a molecular weight of 336.53 g/mol. Its IUPAC name is 1,3-bis[1-(2,5-dimethylthiophen-3-yl)ethyl]urea.
| Compound Name | 1,3-bis[1-(2,5-dimethylthiophen-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 71897547 |
| Molecular Formula | C17H24N2OS2 |
| Molecular Weight | 336.53 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1,3-bis[1-(2,5-dimethylthiophen-3-yl)ethyl]urea |
| SMILES | Cc1cc(C(C)NC(=O)NC(C)c2cc(C)sc2C)c(C)s1 |
| InChI | InChI=1S/C17H24N2OS2/c1-9-7-15(13(5)21-9)11(3)18-17(20)19-12(4)16-8-10(2)22-14(16)6/h7-8,11-12H,1-6H3,(H2,18,19,20) |
| InChIKey | WWHIJTPNMAJRHA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |