C15H25N3O2S — CID 86931458
N-[2-[1-(2,5-dimethylthiophen-3-yl)ethylcarbamoylamino]ethyl]-2-methylpropanamide (PubChem CID 86931458) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is N-[2-[1-(2,5-dimethylthiophen-3-yl)ethylcarbamoylamino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[1-(2,5-dimethylthiophen-3-yl)ethylcarbamoylamino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 86931458 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-[2-[1-(2,5-dimethylthiophen-3-yl)ethylcarbamoylamino]ethyl]-2-methylpropanamide |
| SMILES | Cc1cc(C(C)NC(=O)NCCNC(=O)C(C)C)c(C)s1 |
| InChI | InChI=1S/C15H25N3O2S/c1-9(2)14(19)16-6-7-17-15(20)18-11(4)13-8-10(3)21-12(13)5/h8-9,11H,6-7H2,1-5H3,(H,16,19)(H2,17,18,20) |
| InChIKey | FOVXYPLWMQBQSX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|