C15H17FN2OS — CID 38885273
1-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(2-fluorophenyl)urea (PubChem CID 38885273) has the molecular formula C15H17FN2OS and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 38885273 |
| Molecular Formula | C15H17FN2OS |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-[(1R)-1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(2-fluorophenyl)urea |
| SMILES | Cc1cc([C@@H](C)NC(=O)Nc2ccccc2F)c(C)s1 |
| InChI | InChI=1S/C15H17FN2OS/c1-9-8-12(11(3)20-9)10(2)17-15(19)18-14-7-5-4-6-13(14)16/h4-8,10H,1-3H3,(H2,17,18,19)/t10-/m1/s1 |
| InChIKey | JUECHZCJOWEGAV-SNVBAGLBSA-N |
| XLogP | 4.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |