C14H15F2NS — CID 61076982
N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2,3-difluoroaniline (PubChem CID 61076982) has the molecular formula C14H15F2NS and a molecular weight of 267.34 g/mol. Its IUPAC name is N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2,3-difluoroaniline.
| Compound Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2,3-difluoroaniline |
|---|---|
| PubChem CID | 61076982 |
| Molecular Formula | C14H15F2NS |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2,3-difluoroaniline |
| SMILES | Cc1cc(C(C)Nc2cccc(F)c2F)c(C)s1 |
| InChI | InChI=1S/C14H15F2NS/c1-8-7-11(10(3)18-8)9(2)17-13-6-4-5-12(15)14(13)16/h4-7,9,17H,1-3H3 |
| InChIKey | FWWRMALFQPADQZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |