C15H17ClN2S2 — CID 62497175
2-chloro-6-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide (PubChem CID 62497175) has the molecular formula C15H17ClN2S2 and a molecular weight of 324.90 g/mol. Its IUPAC name is 2-chloro-6-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide.
| Compound Name | 2-chloro-6-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 62497175 |
| Molecular Formula | C15H17ClN2S2 |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-chloro-6-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide |
| SMILES | Cc1cc(C(C)Nc2cccc(Cl)c2C(N)=S)c(C)s1 |
| InChI | InChI=1S/C15H17ClN2S2/c1-8-7-11(10(3)20-8)9(2)18-13-6-4-5-12(16)14(13)15(17)19/h4-7,9,18H,1-3H3,(H2,17,19) |
| InChIKey | PQOWCPCJSRLYJA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|