C14H15ClN2O2S — CID 63541187
2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-6-nitroaniline (PubChem CID 63541187) has the molecular formula C14H15ClN2O2S and a molecular weight of 310.81 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-6-nitroaniline.
| Compound Name | 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-6-nitroaniline |
|---|---|
| PubChem CID | 63541187 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-6-nitroaniline |
| SMILES | Cc1cc(C(C)Nc2c(Cl)cccc2[N+](=O)[O-])c(C)s1 |
| InChI | InChI=1S/C14H15ClN2O2S/c1-8-7-11(10(3)20-8)9(2)16-14-12(15)5-4-6-13(14)17(18)19/h4-7,9,16H,1-3H3 |
| InChIKey | YWOYLRUDICQLRX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|