C14H14F2N2O2S — CID 62531621
N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2,3-difluoro-6-nitroaniline (PubChem CID 62531621) has the molecular formula C14H14F2N2O2S and a molecular weight of 312.34 g/mol. Its IUPAC name is N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2,3-difluoro-6-nitroaniline.
| Compound Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2,3-difluoro-6-nitroaniline |
|---|---|
| PubChem CID | 62531621 |
| Molecular Formula | C14H14F2N2O2S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2,3-difluoro-6-nitroaniline |
| SMILES | Cc1cc(C(C)Nc2c([N+](=O)[O-])ccc(F)c2F)c(C)s1 |
| InChI | InChI=1S/C14H14F2N2O2S/c1-7-6-10(9(3)21-7)8(2)17-14-12(18(19)20)5-4-11(15)13(14)16/h4-6,8,17H,1-3H3 |
| InChIKey | VBTOHJLLRXMWHA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|