C14H16FNS — CID 43106448
N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-fluoroaniline (PubChem CID 43106448) has the molecular formula C14H16FNS and a molecular weight of 249.35 g/mol. Its IUPAC name is N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-fluoroaniline.
| Compound Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 43106448 |
| Molecular Formula | C14H16FNS |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-fluoroaniline |
| SMILES | Cc1cc(C(C)Nc2ccc(F)cc2)c(C)s1 |
| InChI | InChI=1S/C14H16FNS/c1-9-8-14(11(3)17-9)10(2)16-13-6-4-12(15)5-7-13/h4-8,10,16H,1-3H3 |
| InChIKey | UHANLUBCWINPPP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |