C15H18ClNOS — CID 43103753
3-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-methoxyaniline (PubChem CID 43103753) has the molecular formula C15H18ClNOS and a molecular weight of 295.84 g/mol. Its IUPAC name is 3-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-methoxyaniline.
| Compound Name | 3-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 43103753 |
| Molecular Formula | C15H18ClNOS |
| Molecular Weight | 295.84 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 3-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-methoxyaniline |
| SMILES | COc1ccc(NC(C)c2cc(C)sc2C)cc1Cl |
| InChI | InChI=1S/C15H18ClNOS/c1-9-7-13(11(3)19-9)10(2)17-12-5-6-15(18-4)14(16)8-12/h5-8,10,17H,1-4H3 |
| InChIKey | NZQUKJNFLYPMMP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.84 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|