C15H19NO2S — CID 43743593
5-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2-methoxyphenol (PubChem CID 43743593) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is 5-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2-methoxyphenol.
| Compound Name | 5-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2-methoxyphenol |
|---|---|
| PubChem CID | 43743593 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 5-[1-(2,5-dimethylthiophen-3-yl)ethylamino]-2-methoxyphenol |
| SMILES | COc1ccc(NC(C)c2cc(C)sc2C)cc1O |
| InChI | InChI=1S/C15H19NO2S/c1-9-7-13(11(3)19-9)10(2)16-12-5-6-15(18-4)14(17)8-12/h5-8,10,16-17H,1-4H3 |
| InChIKey | XEVYFIOARSSSGF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|