C17H23NO2S — CID 43737447
2-[1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]ethyl]-4-methoxyphenol (PubChem CID 43737447) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is 2-[1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]ethyl]-4-methoxyphenol.
| Compound Name | 2-[1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]ethyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 43737447 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-[1-[1-(2,5-dimethylthiophen-3-yl)ethylamino]ethyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(C(C)NC(C)c2cc(C)sc2C)c1 |
| InChI | InChI=1S/C17H23NO2S/c1-10-8-15(13(4)21-10)11(2)18-12(3)16-9-14(20-5)6-7-17(16)19/h6-9,11-12,18-19H,1-5H3 |
| InChIKey | QJSOQUNJLMPZQO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|