About N-[1-(2,5-dimethylthiophen-3-yl)ethyl]propan-2-amine
N-[1-(2,5-dimethylthiophen-3-yl)ethyl]propan-2-amine (PubChem CID 43200633) has the molecular formula C11H19NS
and a molecular weight of 197.35 g/mol. Its IUPAC name is N-[1-(2,5-dimethylthiophen-3-yl)ethyl]propan-2-amine.
Analyze N-[1-(2,5-dimethylthiophen-3-yl)ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,5-dimethylthiophen-3-yl)ethyl]propan-2-amine?
The IUPAC name of N-[1-(2,5-dimethylthiophen-3-yl)ethyl]propan-2-amine (CID 43200633) is N-[1-(2,5-dimethylthiophen-3-yl)ethyl]propan-2-amine.
What is the SMILES notation for N-[1-(2,5-dimethylthiophen-3-yl)ethyl]propan-2-amine?
The canonical SMILES for N-[1-(2,5-dimethylthiophen-3-yl)ethyl]propan-2-amine is Cc1cc(C(C)NC(C)C)c(C)s1.
What is the InChIKey of N-[1-(2,5-dimethylthiophen-3-yl)ethyl]propan-2-amine?
The InChIKey is WAKAUAFBMKQCCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NS/c1-7(2)12-9(4)11-6-8(3)13-10(11)5/h6-7,9,12H,1-5H3.
What are the key properties of N-[1-(2,5-dimethylthiophen-3-yl)ethyl]propan-2-amine?
N-[1-(2,5-dimethylthiophen-3-yl)ethyl]propan-2-amine has a molecular weight of 197.35 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,5-dimethylthiophen-3-yl)ethyl]propan-2-amine is sourced from PubChem (CID 43200633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).