C10H15BrS — CID 61097945
3-(1-bromo-2-methylpropyl)-2,5-dimethylthiophene (PubChem CID 61097945) has the molecular formula C10H15BrS and a molecular weight of 247.20 g/mol. Its IUPAC name is 3-(1-bromo-2-methylpropyl)-2,5-dimethylthiophene.
| Compound Name | 3-(1-bromo-2-methylpropyl)-2,5-dimethylthiophene |
|---|---|
| PubChem CID | 61097945 |
| Molecular Formula | C10H15BrS |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 3-(1-bromo-2-methylpropyl)-2,5-dimethylthiophene |
| SMILES | Cc1cc(C(Br)C(C)C)c(C)s1 |
| InChI | InChI=1S/C10H15BrS/c1-6(2)10(11)9-5-7(3)12-8(9)4/h5-6,10H,1-4H3 |
| InChIKey | TZDJUCMHWNPHHM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|