C11H15BrF2S — CID 130673620
3-(1-bromo-3,3-difluoro-2-methylbutyl)-2,5-dimethylthiophene (PubChem CID 130673620) has the molecular formula C11H15BrF2S and a molecular weight of 297.21 g/mol. Its IUPAC name is 3-(1-bromo-3,3-difluoro-2-methylbutyl)-2,5-dimethylthiophene.
| Compound Name | 3-(1-bromo-3,3-difluoro-2-methylbutyl)-2,5-dimethylthiophene |
|---|---|
| PubChem CID | 130673620 |
| Molecular Formula | C11H15BrF2S |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 3-(1-bromo-3,3-difluoro-2-methylbutyl)-2,5-dimethylthiophene |
| SMILES | Cc1cc(C(Br)C(C)C(C)(F)F)c(C)s1 |
| InChI | InChI=1S/C11H15BrF2S/c1-6-5-9(8(3)15-6)10(12)7(2)11(4,13)14/h5,7,10H,1-4H3 |
| InChIKey | RRAYWEQWQMBIQP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|