C10H16N2S2 — CID 115579469
1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-methylthiourea (PubChem CID 115579469) has the molecular formula C10H16N2S2 and a molecular weight of 228.39 g/mol. Its IUPAC name is 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-methylthiourea.
| Compound Name | 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-methylthiourea |
|---|---|
| PubChem CID | 115579469 |
| Molecular Formula | C10H16N2S2 |
| Molecular Weight | 228.39 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-methylthiourea |
| SMILES | CNC(=S)NC(C)c1cc(C)sc1C |
| InChI | InChI=1S/C10H16N2S2/c1-6-5-9(8(3)14-6)7(2)12-10(13)11-4/h5,7H,1-4H3,(H2,11,12,13) |
| InChIKey | VURHCAZFJCYCBT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|