C10H14N2S2 — CID 2739271
N,4-dimethyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide (PubChem CID 2739271) has the molecular formula C10H14N2S2 and a molecular weight of 226.37 g/mol. Its IUPAC name is N,4-dimethyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide.
| Compound Name | N,4-dimethyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 2739271 |
| Molecular Formula | C10H14N2S2 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | N,4-dimethyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide |
| SMILES | CNC(=S)N1CCc2sccc2C1C |
| InChI | InChI=1S/C10H14N2S2/c1-7-8-4-6-14-9(8)3-5-12(7)10(13)11-2/h4,6-7H,3,5H2,1-2H3,(H,11,13) |
| InChIKey | DLMYFGHRWKOMJY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|