About 7-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine
7-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine (PubChem CID 14548169) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is 7-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine.
Analyze 7-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine?
The IUPAC name of 7-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine (CID 14548169) is 7-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine.
What is the SMILES notation for 7-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine?
The canonical SMILES for 7-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine is CC1NCCc2ccsc21.
What is the InChIKey of 7-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine?
The InChIKey is NDKKMCDMZGOMPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-6-8-7(2-4-9-6)3-5-10-8/h3,5-6,9H,2,4H2,1H3.
What are the key properties of 7-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine?
7-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine has a molecular weight of 153.25 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine is sourced from PubChem (CID 14548169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).