C21H30N4S2 — CID 12005974
1-[1-(4-methylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-3-(2-phenylethyl)thiourea (PubChem CID 12005974) has the molecular formula C21H30N4S2 and a molecular weight of 402.63 g/mol. Its IUPAC name is 1-[1-(4-methylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[1-(4-methylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 12005974 |
| Molecular Formula | C21H30N4S2 |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-[1-(4-methylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-3-(2-phenylethyl)thiourea |
| SMILES | CC(NC(=S)NCCc1ccccc1)C(c1cccs1)N1CCN(C)CC1 |
| InChI | InChI=1S/C21H30N4S2/c1-17(23-21(26)22-11-10-18-7-4-3-5-8-18)20(19-9-6-16-27-19)25-14-12-24(2)13-15-25/h3-9,16-17,20H,10-15H2,1-2H3,(H2,22,23,26) |
| InChIKey | SOIWUPYQCIVMPD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|