About 7-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine
7-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine (PubChem CID 14548170) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is 7-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine.
Analyze 7-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine?
The IUPAC name of 7-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine (CID 14548170) is 7-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine.
What is the SMILES notation for 7-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine?
The canonical SMILES for 7-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine is CC(C)C1NCCc2ccsc21.
What is the InChIKey of 7-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine?
The InChIKey is ZCNMMQMJTOQMAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NS/c1-7(2)9-10-8(3-5-11-9)4-6-12-10/h4,6-7,9,11H,3,5H2,1-2H3.
What are the key properties of 7-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine?
7-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine has a molecular weight of 181.30 g/mol, XLogP of 2.59, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine is sourced from PubChem (CID 14548170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).