C8H14N2O2S2 — CID 112684505
2,5-dimethyl-3-[1-(sulfamoylamino)ethyl]thiophene (PubChem CID 112684505) has the molecular formula C8H14N2O2S2 and a molecular weight of 234.35 g/mol. Its IUPAC name is 2,5-dimethyl-3-[1-(sulfamoylamino)ethyl]thiophene.
| Compound Name | 2,5-dimethyl-3-[1-(sulfamoylamino)ethyl]thiophene |
|---|---|
| PubChem CID | 112684505 |
| Molecular Formula | C8H14N2O2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2,5-dimethyl-3-[1-(sulfamoylamino)ethyl]thiophene |
| SMILES | Cc1cc(C(C)NS(N)(=O)=O)c(C)s1 |
| InChI | InChI=1S/C8H14N2O2S2/c1-5-4-8(7(3)13-5)6(2)10-14(9,11)12/h4,6,10H,1-3H3,(H2,9,11,12) |
| InChIKey | JVFXYTBSVACHKM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |