C12H19NO4S2 — CID 43697794
4-[1-(2,5-dimethylthiophen-3-yl)ethylsulfamoyl]butanoic acid (PubChem CID 43697794) has the molecular formula C12H19NO4S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-[1-(2,5-dimethylthiophen-3-yl)ethylsulfamoyl]butanoic acid.
| Compound Name | 4-[1-(2,5-dimethylthiophen-3-yl)ethylsulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 43697794 |
| Molecular Formula | C12H19NO4S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-[1-(2,5-dimethylthiophen-3-yl)ethylsulfamoyl]butanoic acid |
| SMILES | Cc1cc(C(C)NS(=O)(=O)CCCC(=O)O)c(C)s1 |
| InChI | InChI=1S/C12H19NO4S2/c1-8-7-11(10(3)18-8)9(2)13-19(16,17)6-4-5-12(14)15/h7,9,13H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | VNZDJJFTMCLZIK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |