4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid

C12H19NO2S — CID 60782598

IUPAC4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid
SMILESCc1cc(C(C)NCCCC(=O)O)c(C)s1
InChIInChI=1S/C12H19NO2S/c1-8-7-11(10(3)16-8)9(2)13-6-4-5-12(14)15/h7,9,13H,4-6H2,1-3H3,(H,14,15)
InChIKeySVCITIHVIQUYHV-UHFFFAOYSA-N
MW241.36 g/mol
LogP2.88
Rot. Bonds6

About 4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid

4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid (PubChem CID 60782598) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid.

Molecular Properties

Compound Name4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid
PubChem CID60782598
Molecular FormulaC12H19NO2S
Molecular Weight241.36 g/mol
Exact Mass241.11
IUPAC Name4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid
SMILESCc1cc(C(C)NCCCC(=O)O)c(C)s1
InChIInChI=1S/C12H19NO2S/c1-8-7-11(10(3)16-8)9(2)13-6-4-5-12(14)15/h7,9,13H,4-6H2,1-3H3,(H,14,15)
InChIKeySVCITIHVIQUYHV-UHFFFAOYSA-N
XLogP2.88
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.36
LogP ≤ 52.88
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid?
The IUPAC name of 4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid (CID 60782598) is 4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid.
What is the SMILES notation for 4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid?
The canonical SMILES for 4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid is Cc1cc(C(C)NCCCC(=O)O)c(C)s1.
What is the InChIKey of 4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid?
The InChIKey is SVCITIHVIQUYHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2S/c1-8-7-11(10(3)16-8)9(2)13-6-4-5-12(14)15/h7,9,13H,4-6H2,1-3H3,(H,14,15).
What are the key properties of 4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid?
4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid has a molecular weight of 241.36 g/mol, XLogP of 2.88, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]butanoic acid is sourced from PubChem (CID 60782598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).