C11H19NOS — CID 43200659
1-(2,5-dimethylthiophen-3-yl)-N-(2-methoxyethyl)ethanamine (PubChem CID 43200659) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)-N-(2-methoxyethyl)ethanamine.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)-N-(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 43200659 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)-N-(2-methoxyethyl)ethanamine |
| SMILES | COCCNC(C)c1cc(C)sc1C |
| InChI | InChI=1S/C11H19NOS/c1-8-7-11(10(3)14-8)9(2)12-5-6-13-4/h7,9,12H,5-6H2,1-4H3 |
| InChIKey | AUXPMLPUHOBNGL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|