C11H17NO3S — CID 62539805
2-(2,5-dimethylthiophen-3-yl)-2-(2-methoxyethylamino)acetic acid (PubChem CID 62539805) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-(2,5-dimethylthiophen-3-yl)-2-(2-methoxyethylamino)acetic acid.
| Compound Name | 2-(2,5-dimethylthiophen-3-yl)-2-(2-methoxyethylamino)acetic acid |
|---|---|
| PubChem CID | 62539805 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-(2,5-dimethylthiophen-3-yl)-2-(2-methoxyethylamino)acetic acid |
| SMILES | COCCNC(C(=O)O)c1cc(C)sc1C |
| InChI | InChI=1S/C11H17NO3S/c1-7-6-9(8(2)16-7)10(11(13)14)12-4-5-15-3/h6,10,12H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | KHDBKNXJVXWSMM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|