C11H14BrNO3 — CID 94479863
(2R)-2-(2-bromophenyl)-2-(2-methoxyethylamino)acetic acid (PubChem CID 94479863) has the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. Its IUPAC name is (2R)-2-(2-bromophenyl)-2-(2-methoxyethylamino)acetic acid.
| Compound Name | (2R)-2-(2-bromophenyl)-2-(2-methoxyethylamino)acetic acid |
|---|---|
| PubChem CID | 94479863 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | (2R)-2-(2-bromophenyl)-2-(2-methoxyethylamino)acetic acid |
| SMILES | COCCN[C@@H](C(=O)O)c1ccccc1Br |
| InChI | InChI=1S/C11H14BrNO3/c1-16-7-6-13-10(11(14)15)8-4-2-3-5-9(8)12/h2-5,10,13H,6-7H2,1H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | VVPZASJPEXKFIH-SNVBAGLBSA-N |
| XLogP | 1.81 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|