(2R)-2-(2-bromophenyl)-2-methoxyacetic acid

C9H9BrO3 — CID 124585261

IUPAC(2R)-2-(2-bromophenyl)-2-methoxyacetic acid
SMILESCO[C@@H](C(=O)O)c1ccccc1Br
InChIInChI=1S/C9H9BrO3/c1-13-8(9(11)12)6-4-2-3-5-7(6)10/h2-5,8H,1H3,(H,11,12)/t8-/m1/s1
InChIKeyCDVMGVHQRHYPBI-MRVPVSSYSA-N
MW245.07 g/mol
LogP2.22
Rot. Bonds3

About (2R)-2-(2-bromophenyl)-2-methoxyacetic acid

(2R)-2-(2-bromophenyl)-2-methoxyacetic acid (PubChem CID 124585261) has the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. Its IUPAC name is (2R)-2-(2-bromophenyl)-2-methoxyacetic acid.

Molecular Properties

Compound Name(2R)-2-(2-bromophenyl)-2-methoxyacetic acid
PubChem CID124585261
Molecular FormulaC9H9BrO3
Molecular Weight245.07 g/mol
Exact Mass243.97
IUPAC Name(2R)-2-(2-bromophenyl)-2-methoxyacetic acid
SMILESCO[C@@H](C(=O)O)c1ccccc1Br
InChIInChI=1S/C9H9BrO3/c1-13-8(9(11)12)6-4-2-3-5-7(6)10/h2-5,8H,1H3,(H,11,12)/t8-/m1/s1
InChIKeyCDVMGVHQRHYPBI-MRVPVSSYSA-N
XLogP2.22
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.07
LogP ≤ 52.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2R)-2-(2-bromophenyl)-2-methoxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2R)-2-(2-chlorophenyl)-2-methoxyacetic acid
CID 91331586
[(1S)-1-(2-bromophenyl)ethyl] (2S)-2-methoxy-2-phenylacetate
CID 10066387
3-(2-bromophenyl)-3-methoxypropanoic acid
CID 83844316
2-(2-fluoro-3-methylphenyl)-2-methoxyacetic acid
CID 130877921
2,3-dibromo-3-(2-bromophenyl)propanoic acid
CID 5127524
(2S,3R)-2,3-dibromo-3-(2-bromophenyl)propanoic acid
CID 95858564
2-(2,3-dimethoxyphenyl)-2-methoxyacetic acid
CID 83224228
2-methoxy-2-(2-thiophen-2-ylphenyl)acetic acid
CID 155667396
2-(2-bromophenyl)-2-(4-methoxyphenoxy)acetyl chloride
CID 163377865
(2R)-2-(2-bromophenyl)-2-(2-methoxyethylamino)acetic acid
CID 94479863
2-(2-bromophenyl)-4-[2-(2-methoxyethoxy)ethoxy]butanoic acid
CID 104565058
2-[2-(2-chloro-1-methoxy-2-oxoethyl)phenyl]-2-methoxyacetyl chloride
CID 88797101

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(2-bromophenyl)-2-methoxyacetic acid?
The IUPAC name of (2R)-2-(2-bromophenyl)-2-methoxyacetic acid (CID 124585261) is (2R)-2-(2-bromophenyl)-2-methoxyacetic acid.
What is the SMILES notation for (2R)-2-(2-bromophenyl)-2-methoxyacetic acid?
The canonical SMILES for (2R)-2-(2-bromophenyl)-2-methoxyacetic acid is CO[C@@H](C(=O)O)c1ccccc1Br.
What is the InChIKey of (2R)-2-(2-bromophenyl)-2-methoxyacetic acid?
The InChIKey is CDVMGVHQRHYPBI-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H9BrO3/c1-13-8(9(11)12)6-4-2-3-5-7(6)10/h2-5,8H,1H3,(H,11,12)/t8-/m1/s1.
What are the key properties of (2R)-2-(2-bromophenyl)-2-methoxyacetic acid?
(2R)-2-(2-bromophenyl)-2-methoxyacetic acid has a molecular weight of 245.07 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2-bromophenyl)-2-methoxyacetic acid is sourced from PubChem (CID 124585261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).