(2R)-2-(2-chlorophenyl)-2-methoxyacetic acid

C9H9ClO3 — CID 91331586

IUPAC(2R)-2-(2-chlorophenyl)-2-methoxyacetic acid
SMILESCO[C@@H](C(=O)O)c1ccccc1Cl
InChIInChI=1S/C9H9ClO3/c1-13-8(9(11)12)6-4-2-3-5-7(6)10/h2-5,8H,1H3,(H,11,12)/t8-/m1/s1
InChIKeyGRSXDEKBULWVIL-MRVPVSSYSA-N
MW200.62 g/mol
LogP2.11
Rot. Bonds3

About (2R)-2-(2-chlorophenyl)-2-methoxyacetic acid

(2R)-2-(2-chlorophenyl)-2-methoxyacetic acid (PubChem CID 91331586) has the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)-2-methoxyacetic acid.

Molecular Properties

Compound Name(2R)-2-(2-chlorophenyl)-2-methoxyacetic acid
PubChem CID91331586
Molecular FormulaC9H9ClO3
Molecular Weight200.62 g/mol
Exact Mass200.02
IUPAC Name(2R)-2-(2-chlorophenyl)-2-methoxyacetic acid
SMILESCO[C@@H](C(=O)O)c1ccccc1Cl
InChIInChI=1S/C9H9ClO3/c1-13-8(9(11)12)6-4-2-3-5-7(6)10/h2-5,8H,1H3,(H,11,12)/t8-/m1/s1
InChIKeyGRSXDEKBULWVIL-MRVPVSSYSA-N
XLogP2.11
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.62
LogP ≤ 52.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2R)-2-(2-chlorophenyl)-2-methoxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1-(2-chlorophenyl)-1-methoxybutan-2-one
CID 83226542
(2R)-2-(2-bromophenyl)-2-methoxyacetic acid
CID 124585261
2-(2-chlorophenyl)-2-methoxy-N-methyl-N-pentan-3-ylacetamide
CID 155964926
2-[2-(2-chloro-1-methoxy-2-oxoethyl)phenyl]-2-methoxyacetyl chloride
CID 88797101
dimethyl 2-(2-chlorophenyl)propanedioate
CID 18710443
3-(2-chlorophenyl)-2-methylbutanoic acid
CID 81008605
2-(2-fluoro-3-methylphenyl)-2-methoxyacetic acid
CID 130877921
2-(5-chloro-2-fluorophenyl)-2-methoxyacetic acid
CID 114868069
2-(2-chlorophenyl)-2-hydroxyacetic acid;copper
CID 174872808
(2R)-2-(2-chlorophenyl)-2-(methylamino)acetic acid
CID 51886753
(2S,3R)-2-(2-chlorophenyl)-3-hydroxybutanoic acid
CID 156875772
2-(2,3-dimethoxyphenyl)-2-methoxyacetic acid
CID 83224228

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(2-chlorophenyl)-2-methoxyacetic acid?
The IUPAC name of (2R)-2-(2-chlorophenyl)-2-methoxyacetic acid (CID 91331586) is (2R)-2-(2-chlorophenyl)-2-methoxyacetic acid.
What is the SMILES notation for (2R)-2-(2-chlorophenyl)-2-methoxyacetic acid?
The canonical SMILES for (2R)-2-(2-chlorophenyl)-2-methoxyacetic acid is CO[C@@H](C(=O)O)c1ccccc1Cl.
What is the InChIKey of (2R)-2-(2-chlorophenyl)-2-methoxyacetic acid?
The InChIKey is GRSXDEKBULWVIL-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H9ClO3/c1-13-8(9(11)12)6-4-2-3-5-7(6)10/h2-5,8H,1H3,(H,11,12)/t8-/m1/s1.
What are the key properties of (2R)-2-(2-chlorophenyl)-2-methoxyacetic acid?
(2R)-2-(2-chlorophenyl)-2-methoxyacetic acid has a molecular weight of 200.62 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2-chlorophenyl)-2-methoxyacetic acid is sourced from PubChem (CID 91331586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).