2,3-dibromo-3-(2-bromophenyl)propanoic acid

C9H7Br3O2 — CID 5127524

IUPAC2,3-dibromo-3-(2-bromophenyl)propanoic acid
SMILESO=C(O)C(Br)C(Br)c1ccccc1Br
InChIInChI=1S/C9H7Br3O2/c10-6-4-2-1-3-5(6)7(11)8(12)9(13)14/h1-4,7-8H,(H,13,14)
InChIKeyIOATZQRJTIURPY-UHFFFAOYSA-N
MW386.87 g/mol
LogP3.73
Rot. Bonds3

About 2,3-dibromo-3-(2-bromophenyl)propanoic acid

2,3-dibromo-3-(2-bromophenyl)propanoic acid (PubChem CID 5127524) has the molecular formula C9H7Br3O2 and a molecular weight of 386.87 g/mol. Its IUPAC name is 2,3-dibromo-3-(2-bromophenyl)propanoic acid.

Molecular Properties

Compound Name2,3-dibromo-3-(2-bromophenyl)propanoic acid
PubChem CID5127524
Molecular FormulaC9H7Br3O2
Molecular Weight386.87 g/mol
Exact Mass383.80
IUPAC Name2,3-dibromo-3-(2-bromophenyl)propanoic acid
SMILESO=C(O)C(Br)C(Br)c1ccccc1Br
InChIInChI=1S/C9H7Br3O2/c10-6-4-2-1-3-5(6)7(11)8(12)9(13)14/h1-4,7-8H,(H,13,14)
InChIKeyIOATZQRJTIURPY-UHFFFAOYSA-N
XLogP3.73
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500386.87
LogP ≤ 53.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2,3-dibromo-3-(2-bromophenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dibromo-3-(2-bromophenyl)propanoic acid?
The IUPAC name of 2,3-dibromo-3-(2-bromophenyl)propanoic acid (CID 5127524) is 2,3-dibromo-3-(2-bromophenyl)propanoic acid.
What is the SMILES notation for 2,3-dibromo-3-(2-bromophenyl)propanoic acid?
The canonical SMILES for 2,3-dibromo-3-(2-bromophenyl)propanoic acid is O=C(O)C(Br)C(Br)c1ccccc1Br.
What is the InChIKey of 2,3-dibromo-3-(2-bromophenyl)propanoic acid?
The InChIKey is IOATZQRJTIURPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Br3O2/c10-6-4-2-1-3-5(6)7(11)8(12)9(13)14/h1-4,7-8H,(H,13,14).
What are the key properties of 2,3-dibromo-3-(2-bromophenyl)propanoic acid?
2,3-dibromo-3-(2-bromophenyl)propanoic acid has a molecular weight of 386.87 g/mol, XLogP of 3.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromo-3-(2-bromophenyl)propanoic acid is sourced from PubChem (CID 5127524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).