C21H24Br2O — CID 141224766
3,5-bis(2-bromophenyl)-2,6-dimethylheptan-4-one (PubChem CID 141224766) has the molecular formula C21H24Br2O and a molecular weight of 452.23 g/mol. Its IUPAC name is 3,5-bis(2-bromophenyl)-2,6-dimethylheptan-4-one.
| Compound Name | 3,5-bis(2-bromophenyl)-2,6-dimethylheptan-4-one |
|---|---|
| PubChem CID | 141224766 |
| Molecular Formula | C21H24Br2O |
| Molecular Weight | 452.23 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 3,5-bis(2-bromophenyl)-2,6-dimethylheptan-4-one |
| SMILES | CC(C)C(C(=O)C(c1ccccc1Br)C(C)C)c1ccccc1Br |
| InChI | InChI=1S/C21H24Br2O/c1-13(2)19(15-9-5-7-11-17(15)22)21(24)20(14(3)4)16-10-6-8-12-18(16)23/h5-14,19-20H,1-4H3 |
| InChIKey | TXQQSICHZLWHTN-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.23 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |