C23H28Br2O — CID 141224768
4,6-bis(2-bromophenyl)-2,8-dimethylnonan-5-one (PubChem CID 141224768) has the molecular formula C23H28Br2O and a molecular weight of 480.28 g/mol. Its IUPAC name is 4,6-bis(2-bromophenyl)-2,8-dimethylnonan-5-one.
| Compound Name | 4,6-bis(2-bromophenyl)-2,8-dimethylnonan-5-one |
|---|---|
| PubChem CID | 141224768 |
| Molecular Formula | C23H28Br2O |
| Molecular Weight | 480.28 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 4,6-bis(2-bromophenyl)-2,8-dimethylnonan-5-one |
| SMILES | CC(C)CC(C(=O)C(CC(C)C)c1ccccc1Br)c1ccccc1Br |
| InChI | InChI=1S/C23H28Br2O/c1-15(2)13-19(17-9-5-7-11-21(17)24)23(26)20(14-16(3)4)18-10-6-8-12-22(18)25/h5-12,15-16,19-20H,13-14H2,1-4H3 |
| InChIKey | OWJGACRFVVASJF-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.28 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |