C11H16BrNO — CID 95465505
(1R,2S)-2-amino-1-(2-bromophenyl)-3-methylbutan-1-ol (PubChem CID 95465505) has the molecular formula C11H16BrNO and a molecular weight of 258.16 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-(2-bromophenyl)-3-methylbutan-1-ol.
| Compound Name | (1R,2S)-2-amino-1-(2-bromophenyl)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 95465505 |
| Molecular Formula | C11H16BrNO |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | (1R,2S)-2-amino-1-(2-bromophenyl)-3-methylbutan-1-ol |
| SMILES | CC(C)[C@H](N)[C@H](O)c1ccccc1Br |
| InChI | InChI=1S/C11H16BrNO/c1-7(2)10(13)11(14)8-5-3-4-6-9(8)12/h3-7,10-11,14H,13H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | OMXIQOUMTLIIMY-WDEREUQCSA-N |
| XLogP | 2.47 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |