C27H25BrOP+ — CID 102140054
[(1R,2S)-1-(2-bromophenyl)-1-hydroxypropan-2-yl]-triphenylphosphanium (PubChem CID 102140054) has the molecular formula C27H25BrOP+ and a molecular weight of 476.37 g/mol. Its IUPAC name is [(1R,2S)-1-(2-bromophenyl)-1-hydroxypropan-2-yl]-triphenylphosphanium.
| Compound Name | [(1R,2S)-1-(2-bromophenyl)-1-hydroxypropan-2-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 102140054 |
| Molecular Formula | C27H25BrOP+ |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | [(1R,2S)-1-(2-bromophenyl)-1-hydroxypropan-2-yl]-triphenylphosphanium |
| SMILES | C[C@@H]([C@H](O)c1ccccc1Br)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25BrOP/c1-21(27(29)25-19-11-12-20-26(25)28)30(22-13-5-2-6-14-22,23-15-7-3-8-16-23)24-17-9-4-10-18-24/h2-21,27,29H,1H3/q+1/t21-,27-/m0/s1 |
| InChIKey | IHOJYYASJILUIV-IDISGSTGSA-N |
| XLogP | 5.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|