C15H10BrF13O — CID 162347557
1-(2-bromophenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-methyloctan-1-ol (PubChem CID 162347557) has the molecular formula C15H10BrF13O and a molecular weight of 533.12 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-methyloctan-1-ol.
| Compound Name | 1-(2-bromophenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-methyloctan-1-ol |
|---|---|
| PubChem CID | 162347557 |
| Molecular Formula | C15H10BrF13O |
| Molecular Weight | 533.12 g/mol |
| Exact Mass | 531.97 |
| IUPAC Name | 1-(2-bromophenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-methyloctan-1-ol |
| SMILES | CC(C(O)c1ccccc1Br)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H10BrF13O/c1-6(9(30)7-4-2-3-5-8(7)16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)29/h2-6,9,30H,1H3 |
| InChIKey | XKWVGERVCVGEER-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.12 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|