C9H6BrCl2F3O — CID 7055498
(1R)-1-(2-bromophenyl)-2,2-dichloro-3,3,3-trifluoropropan-1-ol (PubChem CID 7055498) has the molecular formula C9H6BrCl2F3O and a molecular weight of 337.95 g/mol. Its IUPAC name is (1R)-1-(2-bromophenyl)-2,2-dichloro-3,3,3-trifluoropropan-1-ol.
| Compound Name | (1R)-1-(2-bromophenyl)-2,2-dichloro-3,3,3-trifluoropropan-1-ol |
|---|---|
| PubChem CID | 7055498 |
| Molecular Formula | C9H6BrCl2F3O |
| Molecular Weight | 337.95 g/mol |
| Exact Mass | 335.89 |
| IUPAC Name | (1R)-1-(2-bromophenyl)-2,2-dichloro-3,3,3-trifluoropropan-1-ol |
| SMILES | O[C@H](c1ccccc1Br)C(Cl)(Cl)C(F)(F)F |
| InChI | InChI=1S/C9H6BrCl2F3O/c10-6-4-2-1-3-5(6)7(16)8(11,12)9(13,14)15/h1-4,7,16H/t7-/m1/s1 |
| InChIKey | YYCKRUDDFXWNPC-SSDOTTSWSA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.95 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|