About 1-(2-bromophenyl)-2,2-difluorobut-3-en-1-ol
1-(2-bromophenyl)-2,2-difluorobut-3-en-1-ol (PubChem CID 10945258) has the molecular formula C10H9BrF2O
and a molecular weight of 263.08 g/mol. Its IUPAC name is 1-(2-bromophenyl)-2,2-difluorobut-3-en-1-ol.
Molecular Properties
| Compound Name | 1-(2-bromophenyl)-2,2-difluorobut-3-en-1-ol |
| PubChem CID | 10945258 |
| Molecular Formula | C10H9BrF2O |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 1-(2-bromophenyl)-2,2-difluorobut-3-en-1-ol |
| SMILES | C=CC(F)(F)C(O)c1ccccc1Br |
| InChI | InChI=1S/C10H9BrF2O/c1-2-10(12,13)9(14)7-5-3-4-6-8(7)11/h2-6,9,14H,1H2 |
| InChIKey | UFICYVWRTDOJRB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bromophenyl)-2,2-difluorobut-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromophenyl)-2,2-difluorobut-3-en-1-ol?
The IUPAC name of 1-(2-bromophenyl)-2,2-difluorobut-3-en-1-ol (CID 10945258) is 1-(2-bromophenyl)-2,2-difluorobut-3-en-1-ol.
What is the SMILES notation for 1-(2-bromophenyl)-2,2-difluorobut-3-en-1-ol?
The canonical SMILES for 1-(2-bromophenyl)-2,2-difluorobut-3-en-1-ol is C=CC(F)(F)C(O)c1ccccc1Br.
What is the InChIKey of 1-(2-bromophenyl)-2,2-difluorobut-3-en-1-ol?
The InChIKey is UFICYVWRTDOJRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrF2O/c1-2-10(12,13)9(14)7-5-3-4-6-8(7)11/h2-6,9,14H,1H2.
What are the key properties of 1-(2-bromophenyl)-2,2-difluorobut-3-en-1-ol?
1-(2-bromophenyl)-2,2-difluorobut-3-en-1-ol has a molecular weight of 263.08 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromophenyl)-2,2-difluorobut-3-en-1-ol is sourced from PubChem (CID 10945258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).