C10H8Cl2F2O — CID 134861856
1-(2,4-dichlorophenyl)-2,2-difluorobut-3-en-1-ol (PubChem CID 134861856) has the molecular formula C10H8Cl2F2O and a molecular weight of 253.08 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2,2-difluorobut-3-en-1-ol.
| Compound Name | 1-(2,4-dichlorophenyl)-2,2-difluorobut-3-en-1-ol |
|---|---|
| PubChem CID | 134861856 |
| Molecular Formula | C10H8Cl2F2O |
| Molecular Weight | 253.08 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2,2-difluorobut-3-en-1-ol |
| SMILES | C=CC(F)(F)C(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H8Cl2F2O/c1-2-10(13,14)9(15)7-4-3-6(11)5-8(7)12/h2-5,9,15H,1H2 |
| InChIKey | YTEUFBGWJHEJEO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.08 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|