C10H10Cl2F3NO — CID 171237914
(1R,3R)-3-amino-1-(2,4-dichlorophenyl)-4,4,4-trifluorobutan-1-ol (PubChem CID 171237914) has the molecular formula C10H10Cl2F3NO and a molecular weight of 288.10 g/mol. Its IUPAC name is (1R,3R)-3-amino-1-(2,4-dichlorophenyl)-4,4,4-trifluorobutan-1-ol.
| Compound Name | (1R,3R)-3-amino-1-(2,4-dichlorophenyl)-4,4,4-trifluorobutan-1-ol |
|---|---|
| PubChem CID | 171237914 |
| Molecular Formula | C10H10Cl2F3NO |
| Molecular Weight | 288.10 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | (1R,3R)-3-amino-1-(2,4-dichlorophenyl)-4,4,4-trifluorobutan-1-ol |
| SMILES | N[C@H](C[C@@H](O)c1ccc(Cl)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C10H10Cl2F3NO/c11-5-1-2-6(7(12)3-5)8(17)4-9(16)10(13,14)15/h1-3,8-9,17H,4,16H2/t8-,9-/m1/s1 |
| InChIKey | CSUUIQJJOOPGSO-RKDXNWHRSA-N |
| XLogP | 3.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.10 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |