C10H9F6NO — CID 171237196
(1S,3S)-3-amino-4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butan-1-ol (PubChem CID 171237196) has the molecular formula C10H9F6NO and a molecular weight of 273.18 g/mol. Its IUPAC name is (1S,3S)-3-amino-4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butan-1-ol.
| Compound Name | (1S,3S)-3-amino-4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 171237196 |
| Molecular Formula | C10H9F6NO |
| Molecular Weight | 273.18 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (1S,3S)-3-amino-4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butan-1-ol |
| SMILES | N[C@@H](C[C@H](O)c1cc(F)c(F)cc1F)C(F)(F)F |
| InChI | InChI=1S/C10H9F6NO/c11-5-2-7(13)6(12)1-4(5)8(18)3-9(17)10(14,15)16/h1-2,8-9,18H,3,17H2/t8-,9-/m0/s1 |
| InChIKey | PLZQNVQPJCNCNL-IUCAKERBSA-N |
| XLogP | 2.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|